C20H23FN4O3 — CID 109103429
5-[4-(4-fluorophenyl)piperazine-1-carbonyl]-N-(2-methoxyethyl)pyridine-3-carboxamide (PubChem CID 109103429) has the molecular formula C20H23FN4O3 and a molecular weight of 386.43 g/mol. Its IUPAC name is 5-[4-(4-fluorophenyl)piperazine-1-carbonyl]-N-(2-methoxyethyl)pyridine-3-carboxamide.
| Compound Name | 5-[4-(4-fluorophenyl)piperazine-1-carbonyl]-N-(2-methoxyethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109103429 |
| Molecular Formula | C20H23FN4O3 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 5-[4-(4-fluorophenyl)piperazine-1-carbonyl]-N-(2-methoxyethyl)pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1cncc(C(=O)N2CCN(c3ccc(F)cc3)CC2)c1 |
| InChI | InChI=1S/C20H23FN4O3/c1-28-11-6-23-19(26)15-12-16(14-22-13-15)20(27)25-9-7-24(8-10-25)18-4-2-17(21)3-5-18/h2-5,12-14H,6-11H2,1H3,(H,23,26) |
| InChIKey | CONDGQIRWXOYAU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|