C21H28N4O3 — CID 109228260
[4-(4-methoxyphenyl)piperazin-1-yl]-[5-(3-methoxypropylamino)-3-pyridinyl]methanone (PubChem CID 109228260) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is [4-(4-methoxyphenyl)piperazin-1-yl]-[5-(3-methoxypropylamino)-3-pyridinyl]methanone.
| Compound Name | [4-(4-methoxyphenyl)piperazin-1-yl]-[5-(3-methoxypropylamino)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 109228260 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | [4-(4-methoxyphenyl)piperazin-1-yl]-[5-(3-methoxypropylamino)-3-pyridinyl]methanone |
| SMILES | COCCCNc1cncc(C(=O)N2CCN(c3ccc(OC)cc3)CC2)c1 |
| InChI | InChI=1S/C21H28N4O3/c1-27-13-3-8-23-18-14-17(15-22-16-18)21(26)25-11-9-24(10-12-25)19-4-6-20(28-2)7-5-19/h4-7,14-16,23H,3,8-13H2,1-2H3 |
| InChIKey | SOZXKLFUBYLZLS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|