C22H25N5O2 — CID 109104428
N-[2-(1H-indol-3-yl)ethyl]-5-(4-methylpiperazine-1-carbonyl)pyridine-3-carboxamide (PubChem CID 109104428) has the molecular formula C22H25N5O2 and a molecular weight of 391.48 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-5-(4-methylpiperazine-1-carbonyl)pyridine-3-carboxamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-5-(4-methylpiperazine-1-carbonyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109104428 |
| Molecular Formula | C22H25N5O2 |
| Molecular Weight | 391.48 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-5-(4-methylpiperazine-1-carbonyl)pyridine-3-carboxamide |
| SMILES | CN1CCN(C(=O)c2cncc(C(=O)NCCc3c[nH]c4ccccc34)c2)CC1 |
| InChI | InChI=1S/C22H25N5O2/c1-26-8-10-27(11-9-26)22(29)18-12-17(13-23-14-18)21(28)24-7-6-16-15-25-20-5-3-2-4-19(16)20/h2-5,12-15,25H,6-11H2,1H3,(H,24,28) |
| InChIKey | PUNQSQHWJVJBBK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.48 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |