C24H20N4O2 — CID 109108326
3-N-(3,4-dimethylphenyl)-5-N-quinolin-8-ylpyridine-3,5-dicarboxamide (PubChem CID 109108326) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 3-N-(3,4-dimethylphenyl)-5-N-quinolin-8-ylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-(3,4-dimethylphenyl)-5-N-quinolin-8-ylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109108326 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 3-N-(3,4-dimethylphenyl)-5-N-quinolin-8-ylpyridine-3,5-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)c2cncc(C(=O)Nc3cccc4cccnc34)c2)cc1C |
| InChI | InChI=1S/C24H20N4O2/c1-15-8-9-20(11-16(15)2)27-23(29)18-12-19(14-25-13-18)24(30)28-21-7-3-5-17-6-4-10-26-22(17)21/h3-14H,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | ZGHMMLJGTJJLKA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |