C23H18N4O3 — CID 109108883
3-N-(2-methoxyphenyl)-5-N-quinolin-8-ylpyridine-3,5-dicarboxamide (PubChem CID 109108883) has the molecular formula C23H18N4O3 and a molecular weight of 398.42 g/mol. Its IUPAC name is 3-N-(2-methoxyphenyl)-5-N-quinolin-8-ylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-(2-methoxyphenyl)-5-N-quinolin-8-ylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109108883 |
| Molecular Formula | C23H18N4O3 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 3-N-(2-methoxyphenyl)-5-N-quinolin-8-ylpyridine-3,5-dicarboxamide |
| SMILES | COc1ccccc1NC(=O)c1cncc(C(=O)Nc2cccc3cccnc23)c1 |
| InChI | InChI=1S/C23H18N4O3/c1-30-20-10-3-2-8-18(20)26-22(28)16-12-17(14-24-13-16)23(29)27-19-9-4-6-15-7-5-11-25-21(15)19/h2-14H,1H3,(H,26,28)(H,27,29) |
| InChIKey | WDXVYULXEJBGDE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |