C21H18FN3O2 — CID 109108560
5-N-ethyl-3-N-(3-fluorophenyl)-5-N-phenylpyridine-3,5-dicarboxamide (PubChem CID 109108560) has the molecular formula C21H18FN3O2 and a molecular weight of 363.39 g/mol. Its IUPAC name is 5-N-ethyl-3-N-(3-fluorophenyl)-5-N-phenylpyridine-3,5-dicarboxamide.
| Compound Name | 5-N-ethyl-3-N-(3-fluorophenyl)-5-N-phenylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109108560 |
| Molecular Formula | C21H18FN3O2 |
| Molecular Weight | 363.39 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 5-N-ethyl-3-N-(3-fluorophenyl)-5-N-phenylpyridine-3,5-dicarboxamide |
| SMILES | CCN(C(=O)c1cncc(C(=O)Nc2cccc(F)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C21H18FN3O2/c1-2-25(19-9-4-3-5-10-19)21(27)16-11-15(13-23-14-16)20(26)24-18-8-6-7-17(22)12-18/h3-14H,2H2,1H3,(H,24,26) |
| InChIKey | VANUXVVPQVXOHY-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |