C17H18F2N4O — CID 109112976
6-(cyclohexylamino)-N-(3,4-difluorophenyl)pyridazine-3-carboxamide (PubChem CID 109112976) has the molecular formula C17H18F2N4O and a molecular weight of 332.35 g/mol. Its IUPAC name is 6-(cyclohexylamino)-N-(3,4-difluorophenyl)pyridazine-3-carboxamide.
| Compound Name | 6-(cyclohexylamino)-N-(3,4-difluorophenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109112976 |
| Molecular Formula | C17H18F2N4O |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 6-(cyclohexylamino)-N-(3,4-difluorophenyl)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc(NC2CCCCC2)nn1 |
| InChI | InChI=1S/C17H18F2N4O/c18-13-7-6-12(10-14(13)19)21-17(24)15-8-9-16(23-22-15)20-11-4-2-1-3-5-11/h6-11H,1-5H2,(H,20,23)(H,21,24) |
| InChIKey | AZRNJUDQMUVKIY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |