C18H22N4O — CID 109124960
6-(cycloheptylamino)-N-phenylpyridazine-3-carboxamide (PubChem CID 109124960) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 6-(cycloheptylamino)-N-phenylpyridazine-3-carboxamide.
| Compound Name | 6-(cycloheptylamino)-N-phenylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109124960 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 6-(cycloheptylamino)-N-phenylpyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(NC2CCCCCC2)nn1 |
| InChI | InChI=1S/C18H22N4O/c23-18(20-15-10-6-3-7-11-15)16-12-13-17(22-21-16)19-14-8-4-1-2-5-9-14/h3,6-7,10-14H,1-2,4-5,8-9H2,(H,19,22)(H,20,23) |
| InChIKey | UACZWHSAELGNIG-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |