C17H22ClN5O — CID 109115796
N-[(2-chlorophenyl)methyl]-6-[3-(dimethylamino)propylamino]pyridazine-3-carboxamide (PubChem CID 109115796) has the molecular formula C17H22ClN5O and a molecular weight of 347.85 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]-6-[3-(dimethylamino)propylamino]pyridazine-3-carboxamide.
| Compound Name | N-[(2-chlorophenyl)methyl]-6-[3-(dimethylamino)propylamino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109115796 |
| Molecular Formula | C17H22ClN5O |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]-6-[3-(dimethylamino)propylamino]pyridazine-3-carboxamide |
| SMILES | CN(C)CCCNc1ccc(C(=O)NCc2ccccc2Cl)nn1 |
| InChI | InChI=1S/C17H22ClN5O/c1-23(2)11-5-10-19-16-9-8-15(21-22-16)17(24)20-12-13-6-3-4-7-14(13)18/h3-4,6-9H,5,10-12H2,1-2H3,(H,19,22)(H,20,24) |
| InChIKey | CBCDEIIAPDJIGF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|