C14H24OS — CID 10911664
(4aS,7S,7aS)-6-methylidene-7-pentylsulfanyl-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b]pyran (PubChem CID 10911664) has the molecular formula C14H24OS and a molecular weight of 240.41 g/mol. Its IUPAC name is (4aS,7S,7aS)-6-methylidene-7-pentylsulfanyl-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b]pyran.
| Compound Name | (4aS,7S,7aS)-6-methylidene-7-pentylsulfanyl-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b]pyran |
|---|---|
| PubChem CID | 10911664 |
| Molecular Formula | C14H24OS |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (4aS,7S,7aS)-6-methylidene-7-pentylsulfanyl-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b]pyran |
| SMILES | C=C1C[C@@H]2CCCO[C@@H]2[C@H]1SCCCCC |
| InChI | InChI=1S/C14H24OS/c1-3-4-5-9-16-14-11(2)10-12-7-6-8-15-13(12)14/h12-14H,2-10H2,1H3/t12-,13-,14-/m0/s1 |
| InChIKey | DFZYULCIRHLIJA-IHRRRGAJSA-N |
| XLogP | 4.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|