C10H15FO — CID 123177508
8-fluoro-6-methylidene-2,3,4,4a,5,7,8,8a-octahydrochromene (PubChem CID 123177508) has the molecular formula C10H15FO and a molecular weight of 170.23 g/mol. Its IUPAC name is 8-fluoro-6-methylidene-2,3,4,4a,5,7,8,8a-octahydrochromene.
| Compound Name | 8-fluoro-6-methylidene-2,3,4,4a,5,7,8,8a-octahydrochromene |
|---|---|
| PubChem CID | 123177508 |
| Molecular Formula | C10H15FO |
| Molecular Weight | 170.23 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 8-fluoro-6-methylidene-2,3,4,4a,5,7,8,8a-octahydrochromene |
| SMILES | C=C1CC(F)C2OCCCC2C1 |
| InChI | InChI=1S/C10H15FO/c1-7-5-8-3-2-4-12-10(8)9(11)6-7/h8-10H,1-6H2 |
| InChIKey | MZQBQYUBIGSWQL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|