C11H18O2 — CID 169492968
3,10-dioxatricyclo[7.3.1.02,7]tridecane (PubChem CID 169492968) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 3,10-dioxatricyclo[7.3.1.02,7]tridecane.
| Compound Name | 3,10-dioxatricyclo[7.3.1.02,7]tridecane |
|---|---|
| PubChem CID | 169492968 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 3,10-dioxatricyclo[7.3.1.02,7]tridecane |
| SMILES | C1COC2C(C1)CC1CC2CCO1 |
| InChI | InChI=1S/C11H18O2/c1-2-8-6-10-7-9(3-5-12-10)11(8)13-4-1/h8-11H,1-7H2 |
| InChIKey | RMANUACFDZGNKI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |