C14H22O2 — CID 174198875
5-(2-oxabicyclo[4.1.0]heptan-7-yl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran (PubChem CID 174198875) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 5-(2-oxabicyclo[4.1.0]heptan-7-yl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran.
| Compound Name | 5-(2-oxabicyclo[4.1.0]heptan-7-yl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
|---|---|
| PubChem CID | 174198875 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 5-(2-oxabicyclo[4.1.0]heptan-7-yl)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran |
| SMILES | C1COC2C(C1)C2C1CCC2OCCC2C1 |
| InChI | InChI=1S/C14H22O2/c1-2-11-13(14(11)16-6-1)10-3-4-12-9(8-10)5-7-15-12/h9-14H,1-8H2 |
| InChIKey | BXAUWWJQWIKJDS-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |