C18H32O3S — CID 123204596
2-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-6-yl)-2,5-dimethylthiolan-3-yl]propane-1,1-diol (PubChem CID 123204596) has the molecular formula C18H32O3S and a molecular weight of 328.52 g/mol. Its IUPAC name is 2-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-6-yl)-2,5-dimethylthiolan-3-yl]propane-1,1-diol.
| Compound Name | 2-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-6-yl)-2,5-dimethylthiolan-3-yl]propane-1,1-diol |
|---|---|
| PubChem CID | 123204596 |
| Molecular Formula | C18H32O3S |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | 2-[4-(3,4,4a,5,6,7,8,8a-octahydro-2H-chromen-6-yl)-2,5-dimethylthiolan-3-yl]propane-1,1-diol |
| SMILES | CC1SC(C)C(C(C)C(O)O)C1C1CCC2OCCCC2C1 |
| InChI | InChI=1S/C18H32O3S/c1-10(18(19)20)16-11(2)22-12(3)17(16)14-6-7-15-13(9-14)5-4-8-21-15/h10-20H,4-9H2,1-3H3 |
| InChIKey | IOJIAPOHBJFORI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|