C10H16BrNO — CID 123529544
6-bromo-8-methylidene-2,3,4,4a,5,6,7,8a-octahydrochromen-5-amine (PubChem CID 123529544) has the molecular formula C10H16BrNO and a molecular weight of 246.15 g/mol. Its IUPAC name is 6-bromo-8-methylidene-2,3,4,4a,5,6,7,8a-octahydrochromen-5-amine.
| Compound Name | 6-bromo-8-methylidene-2,3,4,4a,5,6,7,8a-octahydrochromen-5-amine |
|---|---|
| PubChem CID | 123529544 |
| Molecular Formula | C10H16BrNO |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 6-bromo-8-methylidene-2,3,4,4a,5,6,7,8a-octahydrochromen-5-amine |
| SMILES | C=C1CC(Br)C(N)C2CCCOC12 |
| InChI | InChI=1S/C10H16BrNO/c1-6-5-8(11)9(12)7-3-2-4-13-10(6)7/h7-10H,1-5,12H2 |
| InChIKey | VFGUYCGYCSXQTE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|