C11H15F2NO — CID 170204877
(2R,3S)-2-(2,5-difluorocyclohexa-1,5-dien-1-yl)oxan-3-amine (PubChem CID 170204877) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is (2R,3S)-2-(2,5-difluorocyclohexa-1,5-dien-1-yl)oxan-3-amine.
| Compound Name | (2R,3S)-2-(2,5-difluorocyclohexa-1,5-dien-1-yl)oxan-3-amine |
|---|---|
| PubChem CID | 170204877 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (2R,3S)-2-(2,5-difluorocyclohexa-1,5-dien-1-yl)oxan-3-amine |
| SMILES | N[C@H]1CCCO[C@@H]1C1=C(F)CCC(F)=C1 |
| InChI | InChI=1S/C11H15F2NO/c12-7-3-4-9(13)8(6-7)11-10(14)2-1-5-15-11/h6,10-11H,1-5,14H2/t10-,11+/m0/s1 |
| InChIKey | QBISOXKXLJIRMB-WDEREUQCSA-N |
| XLogP | 2.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |