C21H21FN4O — CID 109119228
6-[(2-fluorophenyl)methylamino]-N-(2-propan-2-ylphenyl)pyridazine-3-carboxamide (PubChem CID 109119228) has the molecular formula C21H21FN4O and a molecular weight of 364.42 g/mol. Its IUPAC name is 6-[(2-fluorophenyl)methylamino]-N-(2-propan-2-ylphenyl)pyridazine-3-carboxamide.
| Compound Name | 6-[(2-fluorophenyl)methylamino]-N-(2-propan-2-ylphenyl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109119228 |
| Molecular Formula | C21H21FN4O |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 6-[(2-fluorophenyl)methylamino]-N-(2-propan-2-ylphenyl)pyridazine-3-carboxamide |
| SMILES | CC(C)c1ccccc1NC(=O)c1ccc(NCc2ccccc2F)nn1 |
| InChI | InChI=1S/C21H21FN4O/c1-14(2)16-8-4-6-10-18(16)24-21(27)19-11-12-20(26-25-19)23-13-15-7-3-5-9-17(15)22/h3-12,14H,13H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | RCMGJPUFOGMTBQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |