C20H20N4O — CID 109120604
6-anilino-N-benzyl-N-ethylpyridazine-3-carboxamide (PubChem CID 109120604) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 6-anilino-N-benzyl-N-ethylpyridazine-3-carboxamide.
| Compound Name | 6-anilino-N-benzyl-N-ethylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109120604 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 6-anilino-N-benzyl-N-ethylpyridazine-3-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1ccc(Nc2ccccc2)nn1 |
| InChI | InChI=1S/C20H20N4O/c1-2-24(15-16-9-5-3-6-10-16)20(25)18-13-14-19(23-22-18)21-17-11-7-4-8-12-17/h3-14H,2,15H2,1H3,(H,21,23) |
| InChIKey | SZKXXVPBPLHVTP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |