C16H17F3N4O — CID 109124462
N,N-diethyl-6-[4-(trifluoromethyl)anilino]pyridazine-3-carboxamide (PubChem CID 109124462) has the molecular formula C16H17F3N4O and a molecular weight of 338.33 g/mol. Its IUPAC name is N,N-diethyl-6-[4-(trifluoromethyl)anilino]pyridazine-3-carboxamide.
| Compound Name | N,N-diethyl-6-[4-(trifluoromethyl)anilino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109124462 |
| Molecular Formula | C16H17F3N4O |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | N,N-diethyl-6-[4-(trifluoromethyl)anilino]pyridazine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(Nc2ccc(C(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C16H17F3N4O/c1-3-23(4-2)15(24)13-9-10-14(22-21-13)20-12-7-5-11(6-8-12)16(17,18)19/h5-10H,3-4H2,1-2H3,(H,20,22) |
| InChIKey | WDZFEIKBMHKIRW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |