C21H19F2N5O — CID 109123134
N-(3,4-difluorophenyl)-6-(4-phenylpiperazin-1-yl)pyridazine-3-carboxamide (PubChem CID 109123134) has the molecular formula C21H19F2N5O and a molecular weight of 395.41 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-6-(4-phenylpiperazin-1-yl)pyridazine-3-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-6-(4-phenylpiperazin-1-yl)pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109123134 |
| Molecular Formula | C21H19F2N5O |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-(3,4-difluorophenyl)-6-(4-phenylpiperazin-1-yl)pyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)c1ccc(N2CCN(c3ccccc3)CC2)nn1 |
| InChI | InChI=1S/C21H19F2N5O/c22-17-7-6-15(14-18(17)23)24-21(29)19-8-9-20(26-25-19)28-12-10-27(11-13-28)16-4-2-1-3-5-16/h1-9,14H,10-13H2,(H,24,29) |
| InChIKey | JJDNYCBUBDZICE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |