C15H12F3N — CID 10912345
N-benzyl-2,2,2-trifluoro-1-phenylethanimine (PubChem CID 10912345) has the molecular formula C15H12F3N and a molecular weight of 263.26 g/mol. Its IUPAC name is N-benzyl-2,2,2-trifluoro-1-phenylethanimine.
| Compound Name | N-benzyl-2,2,2-trifluoro-1-phenylethanimine |
|---|---|
| PubChem CID | 10912345 |
| Molecular Formula | C15H12F3N |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-benzyl-2,2,2-trifluoro-1-phenylethanimine |
| SMILES | FC(F)(F)/C(=N/Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12F3N/c16-15(17,18)14(13-9-5-2-6-10-13)19-11-12-7-3-1-4-8-12/h1-10H,11H2/b19-14+ |
| InChIKey | BLOMGUKPUAIVAE-XMHGGMMESA-N |
| XLogP | 4.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|