C17H27N5O3 — CID 109123862
ethyl 4-[6-[butyl(methyl)amino]pyridazine-3-carbonyl]piperazine-1-carboxylate (PubChem CID 109123862) has the molecular formula C17H27N5O3 and a molecular weight of 349.44 g/mol. Its IUPAC name is ethyl 4-[6-[butyl(methyl)amino]pyridazine-3-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-[butyl(methyl)amino]pyridazine-3-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109123862 |
| Molecular Formula | C17H27N5O3 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | ethyl 4-[6-[butyl(methyl)amino]pyridazine-3-carbonyl]piperazine-1-carboxylate |
| SMILES | CCCCN(C)c1ccc(C(=O)N2CCN(C(=O)OCC)CC2)nn1 |
| InChI | InChI=1S/C17H27N5O3/c1-4-6-9-20(3)15-8-7-14(18-19-15)16(23)21-10-12-22(13-11-21)17(24)25-5-2/h7-8H,4-6,9-13H2,1-3H3 |
| InChIKey | MOFJMURCRNONKU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |