C21H27N5O3 — CID 109123908
ethyl 4-[6-(N-ethyl-3-methylanilino)pyridazine-3-carbonyl]piperazine-1-carboxylate (PubChem CID 109123908) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is ethyl 4-[6-(N-ethyl-3-methylanilino)pyridazine-3-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-(N-ethyl-3-methylanilino)pyridazine-3-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 109123908 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | ethyl 4-[6-(N-ethyl-3-methylanilino)pyridazine-3-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc(N(CC)c3cccc(C)c3)nn2)CC1 |
| InChI | InChI=1S/C21H27N5O3/c1-4-26(17-8-6-7-16(3)15-17)19-10-9-18(22-23-19)20(27)24-11-13-25(14-12-24)21(28)29-5-2/h6-10,15H,4-5,11-14H2,1-3H3 |
| InChIKey | ALEKQNJLCDKMCA-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 78.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |