C17H21NO2 — CID 10912624
(2E,4E)-1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]hexa-2,4-dien-1-one (PubChem CID 10912624) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is (2E,4E)-1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]hexa-2,4-dien-1-one.
| Compound Name | (2E,4E)-1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 10912624 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | (2E,4E)-1-[(4S)-2,2-dimethyl-4-phenyl-1,3-oxazolidin-3-yl]hexa-2,4-dien-1-one |
| SMILES | C/C=C/C=C/C(=O)N1[C@@H](c2ccccc2)COC1(C)C |
| InChI | InChI=1S/C17H21NO2/c1-4-5-7-12-16(19)18-15(13-20-17(18,2)3)14-10-8-6-9-11-14/h4-12,15H,13H2,1-3H3/b5-4+,12-7+/t15-/m1/s1 |
| InChIKey | RKVHTUFRPWKKGC-ACGXUAEMSA-N |
| XLogP | 3.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|