C14H19N5O — CID 10912691
(2S)-1-[2-[2-(pyridin-2-ylamino)ethylamino]acetyl]pyrrolidine-2-carbonitrile (PubChem CID 10912691) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is (2S)-1-[2-[2-(pyridin-2-ylamino)ethylamino]acetyl]pyrrolidine-2-carbonitrile.
| Compound Name | (2S)-1-[2-[2-(pyridin-2-ylamino)ethylamino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| PubChem CID | 10912691 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | (2S)-1-[2-[2-(pyridin-2-ylamino)ethylamino]acetyl]pyrrolidine-2-carbonitrile |
| SMILES | N#C[C@@H]1CCCN1C(=O)CNCCNc1ccccn1 |
| InChI | InChI=1S/C14H19N5O/c15-10-12-4-3-9-19(12)14(20)11-16-7-8-18-13-5-1-2-6-17-13/h1-2,5-6,12,16H,3-4,7-9,11H2,(H,17,18)/t12-/m0/s1 |
| InChIKey | STWTYQOXUTUWAW-LBPRGKRZSA-N |
| XLogP | 0.60 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|