C12H14ClN5O — CID 10912901
2-[(6-chloro-3-pyridinyl)methyl-methylamino]-2-cyanoimino-N,N-dimethylacetamide (PubChem CID 10912901) has the molecular formula C12H14ClN5O and a molecular weight of 279.73 g/mol. Its IUPAC name is 2-[(6-chloro-3-pyridinyl)methyl-methylamino]-2-cyanoimino-N,N-dimethylacetamide.
| Compound Name | 2-[(6-chloro-3-pyridinyl)methyl-methylamino]-2-cyanoimino-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 10912901 |
| Molecular Formula | C12H14ClN5O |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-[(6-chloro-3-pyridinyl)methyl-methylamino]-2-cyanoimino-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)/C(=N\C#N)N(C)Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H14ClN5O/c1-17(2)12(19)11(16-8-14)18(3)7-9-4-5-10(13)15-6-9/h4-6H,7H2,1-3H3/b16-11+ |
| InChIKey | HMSZPFJXPIEETJ-LFIBNONCSA-N |
| XLogP | 1.13 |
| TPSA | 72.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|