C17H29N3O4 — CID 109131267
ethyl 4-[[2-(butylcarbamoyl)cyclopropanecarbonyl]amino]piperidine-1-carboxylate (PubChem CID 109131267) has the molecular formula C17H29N3O4 and a molecular weight of 339.44 g/mol. Its IUPAC name is ethyl 4-[[2-(butylcarbamoyl)cyclopropanecarbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(butylcarbamoyl)cyclopropanecarbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109131267 |
| Molecular Formula | C17H29N3O4 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | ethyl 4-[[2-(butylcarbamoyl)cyclopropanecarbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCCCNC(=O)C1CC1C(=O)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C17H29N3O4/c1-3-5-8-18-15(21)13-11-14(13)16(22)19-12-6-9-20(10-7-12)17(23)24-4-2/h12-14H,3-11H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | FUFCDNNHBXQVSP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|