C17H25N3O4S — CID 109131648
1-N-butan-2-yl-2-N-[2-(4-sulfamoylphenyl)ethyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109131648) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-N-butan-2-yl-2-N-[2-(4-sulfamoylphenyl)ethyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-butan-2-yl-2-N-[2-(4-sulfamoylphenyl)ethyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109131648 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-N-butan-2-yl-2-N-[2-(4-sulfamoylphenyl)ethyl]cyclopropane-1,2-dicarboxamide |
| SMILES | CCC(C)NC(=O)C1CC1C(=O)NCCc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C17H25N3O4S/c1-3-11(2)20-17(22)15-10-14(15)16(21)19-9-8-12-4-6-13(7-5-12)25(18,23)24/h4-7,11,14-15H,3,8-10H2,1-2H3,(H,19,21)(H,20,22)(H2,18,23,24) |
| InChIKey | AOADCMXLJBPUCP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |