C17H25N3O4S — CID 113182044
1-(2-methylpropyl)-5-oxo-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-3-carboxamide (PubChem CID 113182044) has the molecular formula C17H25N3O4S and a molecular weight of 367.47 g/mol. Its IUPAC name is 1-(2-methylpropyl)-5-oxo-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(2-methylpropyl)-5-oxo-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113182044 |
| Molecular Formula | C17H25N3O4S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | 1-(2-methylpropyl)-5-oxo-N-[2-(4-sulfamoylphenyl)ethyl]pyrrolidine-3-carboxamide |
| SMILES | CC(C)CN1CC(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)CC1=O |
| InChI | InChI=1S/C17H25N3O4S/c1-12(2)10-20-11-14(9-16(20)21)17(22)19-8-7-13-3-5-15(6-4-13)25(18,23)24/h3-6,12,14H,7-11H2,1-2H3,(H,19,22)(H2,18,23,24) |
| InChIKey | GGCULWQICHIOFY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |