C17H16ClN3O2 — CID 1091337
(3R)-3-[(4-chlorophenyl)methyl]-1-(4,6-dimethylpyrimidin-2-yl)pyrrolidine-2,5-dione (PubChem CID 1091337) has the molecular formula C17H16ClN3O2 and a molecular weight of 329.79 g/mol. Its IUPAC name is (3R)-3-[(4-chlorophenyl)methyl]-1-(4,6-dimethylpyrimidin-2-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[(4-chlorophenyl)methyl]-1-(4,6-dimethylpyrimidin-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 1091337 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (3R)-3-[(4-chlorophenyl)methyl]-1-(4,6-dimethylpyrimidin-2-yl)pyrrolidine-2,5-dione |
| SMILES | Cc1cc(C)nc(N2C(=O)C[C@@H](Cc3ccc(Cl)cc3)C2=O)n1 |
| InChI | InChI=1S/C17H16ClN3O2/c1-10-7-11(2)20-17(19-10)21-15(22)9-13(16(21)23)8-12-3-5-14(18)6-4-12/h3-7,13H,8-9H2,1-2H3/t13-/m1/s1 |
| InChIKey | CUABEYPNNCWQNL-CYBMUJFWSA-N |
| XLogP | 2.87 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|