C19H19ClN2O2 — CID 109135664
2-N-(3-chlorophenyl)-1-N-(1-phenylethyl)cyclopropane-1,2-dicarboxamide (PubChem CID 109135664) has the molecular formula C19H19ClN2O2 and a molecular weight of 342.83 g/mol. Its IUPAC name is 2-N-(3-chlorophenyl)-1-N-(1-phenylethyl)cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-(3-chlorophenyl)-1-N-(1-phenylethyl)cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109135664 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-N-(3-chlorophenyl)-1-N-(1-phenylethyl)cyclopropane-1,2-dicarboxamide |
| SMILES | CC(NC(=O)C1CC1C(=O)Nc1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C19H19ClN2O2/c1-12(13-6-3-2-4-7-13)21-18(23)16-11-17(16)19(24)22-15-9-5-8-14(20)10-15/h2-10,12,16-17H,11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | FGLCPFHZCCRSAU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |