C24H29N3O2 — CID 109136754
N-benzyl-N-ethyl-2-(4-phenylpiperazine-1-carbonyl)cyclopropane-1-carboxamide (PubChem CID 109136754) has the molecular formula C24H29N3O2 and a molecular weight of 391.51 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-(4-phenylpiperazine-1-carbonyl)cyclopropane-1-carboxamide.
| Compound Name | N-benzyl-N-ethyl-2-(4-phenylpiperazine-1-carbonyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 109136754 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | N-benzyl-N-ethyl-2-(4-phenylpiperazine-1-carbonyl)cyclopropane-1-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C1CC1C(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C24H29N3O2/c1-2-25(18-19-9-5-3-6-10-19)23(28)21-17-22(21)24(29)27-15-13-26(14-16-27)20-11-7-4-8-12-20/h3-12,21-22H,2,13-18H2,1H3 |
| InChIKey | QIHIBYRETARPLY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |