C18H12F2N2O — CID 10913914
4-ethoxy-6,7-difluoro-2-phenylquinoline-3-carbonitrile (PubChem CID 10913914) has the molecular formula C18H12F2N2O and a molecular weight of 310.30 g/mol. Its IUPAC name is 4-ethoxy-6,7-difluoro-2-phenylquinoline-3-carbonitrile.
| Compound Name | 4-ethoxy-6,7-difluoro-2-phenylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 10913914 |
| Molecular Formula | C18H12F2N2O |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 4-ethoxy-6,7-difluoro-2-phenylquinoline-3-carbonitrile |
| SMILES | CCOc1c(C#N)c(-c2ccccc2)nc2cc(F)c(F)cc12 |
| InChI | InChI=1S/C18H12F2N2O/c1-2-23-18-12-8-14(19)15(20)9-16(12)22-17(13(18)10-21)11-6-4-3-5-7-11/h3-9H,2H2,1H3 |
| InChIKey | KBBIABGBQWEAES-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |