C15H31NO2SSi — CID 10914119
N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-trimethylsilylethanesulfonamide (PubChem CID 10914119) has the molecular formula C15H31NO2SSi and a molecular weight of 317.57 g/mol. Its IUPAC name is N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-trimethylsilylethanesulfonamide.
| Compound Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-trimethylsilylethanesulfonamide |
|---|---|
| PubChem CID | 10914119 |
| Molecular Formula | C15H31NO2SSi |
| Molecular Weight | 317.57 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N-[(2E)-3,7-dimethylocta-2,6-dienyl]-2-trimethylsilylethanesulfonamide |
| SMILES | CC(C)=CCC/C(C)=C/CNS(=O)(=O)CC[Si](C)(C)C |
| InChI | InChI=1S/C15H31NO2SSi/c1-14(2)8-7-9-15(3)10-11-16-19(17,18)12-13-20(4,5)6/h8,10,16H,7,9,11-13H2,1-6H3/b15-10+ |
| InChIKey | QRHWTODEOUHEJJ-XNTDXEJSSA-N |
| XLogP | 3.94 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|