C21H26N4O3 — CID 109143974
1-N-(5-methyl-1,2-oxazol-3-yl)-2-N-[4-(4-methylpiperidin-1-yl)phenyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109143974) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-N-(5-methyl-1,2-oxazol-3-yl)-2-N-[4-(4-methylpiperidin-1-yl)phenyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(5-methyl-1,2-oxazol-3-yl)-2-N-[4-(4-methylpiperidin-1-yl)phenyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109143974 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1-N-(5-methyl-1,2-oxazol-3-yl)-2-N-[4-(4-methylpiperidin-1-yl)phenyl]cyclopropane-1,2-dicarboxamide |
| SMILES | Cc1cc(NC(=O)C2CC2C(=O)Nc2ccc(N3CCC(C)CC3)cc2)no1 |
| InChI | InChI=1S/C21H26N4O3/c1-13-7-9-25(10-8-13)16-5-3-15(4-6-16)22-20(26)17-12-18(17)21(27)23-19-11-14(2)28-24-19/h3-6,11,13,17-18H,7-10,12H2,1-2H3,(H,22,26)(H,23,24,27) |
| InChIKey | NROZAAHCHKHFMX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|