C20H25N5O3 — CID 109143981
1-N-(5-methyl-1,2-oxazol-3-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]cyclopropane-1,2-dicarboxamide (PubChem CID 109143981) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-N-(5-methyl-1,2-oxazol-3-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 1-N-(5-methyl-1,2-oxazol-3-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 109143981 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | 1-N-(5-methyl-1,2-oxazol-3-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]cyclopropane-1,2-dicarboxamide |
| SMILES | Cc1cc(NC(=O)C2CC2C(=O)Nc2ccc(N3CCN(C)CC3)cc2)no1 |
| InChI | InChI=1S/C20H25N5O3/c1-13-11-18(23-28-13)22-20(27)17-12-16(17)19(26)21-14-3-5-15(6-4-14)25-9-7-24(2)8-10-25/h3-6,11,16-17H,7-10,12H2,1-2H3,(H,21,26)(H,22,23,27) |
| InChIKey | ZSGVVUDEZUJCOC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|