C20H27N5O4 — CID 55481956
3-[methyl-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]amino]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 55481956) has the molecular formula C20H27N5O4 and a molecular weight of 401.47 g/mol. Its IUPAC name is 3-[methyl-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]amino]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | 3-[methyl-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]amino]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 55481956 |
| Molecular Formula | C20H27N5O4 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-[methyl-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]amino]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | Cc1cc(NC(=O)CN(C)CCC(=O)Nc2ccc(N3CCOCC3)cc2)no1 |
| InChI | InChI=1S/C20H27N5O4/c1-15-13-18(23-29-15)22-20(27)14-24(2)8-7-19(26)21-16-3-5-17(6-4-16)25-9-11-28-12-10-25/h3-6,13H,7-12,14H2,1-2H3,(H,21,26)(H,22,23,27) |
| InChIKey | XHYXDNZVPJRDTG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 99.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|