C22H29N5O3 — CID 56526675
3-[methyl-[2-[(4-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 56526675) has the molecular formula C22H29N5O3 and a molecular weight of 411.51 g/mol. Its IUPAC name is 3-[methyl-[2-[(4-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | 3-[methyl-[2-[(4-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 56526675 |
| Molecular Formula | C22H29N5O3 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 3-[methyl-[2-[(4-methyl-2-pyridinyl)amino]-2-oxoethyl]amino]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | Cc1ccnc(NC(=O)CN(C)CCC(=O)Nc2ccc(N3CCOCC3)cc2)c1 |
| InChI | InChI=1S/C22H29N5O3/c1-17-7-9-23-20(15-17)25-22(29)16-26(2)10-8-21(28)24-18-3-5-19(6-4-18)27-11-13-30-14-12-27/h3-7,9,15H,8,10-14,16H2,1-2H3,(H,24,28)(H,23,25,29) |
| InChIKey | RMOURCWDWLAVRX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|