C19H25FN2O3 — CID 109146968
4-N-(4-fluorophenyl)-1-N-(oxolan-2-ylmethyl)cyclohexane-1,4-dicarboxamide (PubChem CID 109146968) has the molecular formula C19H25FN2O3 and a molecular weight of 348.42 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-1-N-(oxolan-2-ylmethyl)cyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-(4-fluorophenyl)-1-N-(oxolan-2-ylmethyl)cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109146968 |
| Molecular Formula | C19H25FN2O3 |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 4-N-(4-fluorophenyl)-1-N-(oxolan-2-ylmethyl)cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(NCC1CCCO1)C1CCC(C(=O)Nc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H25FN2O3/c20-15-7-9-16(10-8-15)22-19(24)14-5-3-13(4-6-14)18(23)21-12-17-2-1-11-25-17/h7-10,13-14,17H,1-6,11-12H2,(H,21,23)(H,22,24) |
| InChIKey | MOKSDWSUNZBPSP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |