C22H31N3O6 — CID 171339991
4-acetamido-N-[4-(oxolan-2-ylmethylcarbamoyl)cyclohexyl]benzamide;formic acid (PubChem CID 171339991) has the molecular formula C22H31N3O6 and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-acetamido-N-[4-(oxolan-2-ylmethylcarbamoyl)cyclohexyl]benzamide;formic acid.
| Compound Name | 4-acetamido-N-[4-(oxolan-2-ylmethylcarbamoyl)cyclohexyl]benzamide;formic acid |
|---|---|
| PubChem CID | 171339991 |
| Molecular Formula | C22H31N3O6 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 4-acetamido-N-[4-(oxolan-2-ylmethylcarbamoyl)cyclohexyl]benzamide;formic acid |
| SMILES | CC(=O)Nc1ccc(C(=O)NC2CCC(C(=O)NCC3CCCO3)CC2)cc1.O=CO |
| InChI | InChI=1S/C21H29N3O4.CH2O2/c1-14(25)23-17-8-6-16(7-9-17)21(27)24-18-10-4-15(5-11-18)20(26)22-13-19-3-2-12-28-19;2-1-3/h6-9,15,18-19H,2-5,10-13H2,1H3,(H,22,26)(H,23,25)(H,24,27);1H,(H,2,3) |
| InChIKey | DWFJFRUOTFHMPS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|