C16H25F3O2S — CID 10914716
(2E,6E)-3,7,11-trimethyl-1-(trifluoromethylsulfonyl)dodeca-2,6,10-triene (PubChem CID 10914716) has the molecular formula C16H25F3O2S and a molecular weight of 338.44 g/mol. Its IUPAC name is (2E,6E)-3,7,11-trimethyl-1-(trifluoromethylsulfonyl)dodeca-2,6,10-triene.
| Compound Name | (2E,6E)-3,7,11-trimethyl-1-(trifluoromethylsulfonyl)dodeca-2,6,10-triene |
|---|---|
| PubChem CID | 10914716 |
| Molecular Formula | C16H25F3O2S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (2E,6E)-3,7,11-trimethyl-1-(trifluoromethylsulfonyl)dodeca-2,6,10-triene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H25F3O2S/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-22(20,21)16(17,18)19/h7,9,11H,5-6,8,10,12H2,1-4H3/b14-9+,15-11+ |
| InChIKey | XROJEXNSTCFEIB-YFVJMOTDSA-N |
| XLogP | 5.34 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|