C13H25F3O3S2Sn — CID 134872218
[2-cyclopentylideneethyl-methyl-(trimethylstannylmethyl)-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 134872218) has the molecular formula C13H25F3O3S2Sn and a molecular weight of 469.18 g/mol. Its IUPAC name is [2-cyclopentylideneethyl-methyl-(trimethylstannylmethyl)-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [2-cyclopentylideneethyl-methyl-(trimethylstannylmethyl)-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134872218 |
| Molecular Formula | C13H25F3O3S2Sn |
| Molecular Weight | 469.18 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | [2-cyclopentylideneethyl-methyl-(trimethylstannylmethyl)-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CS(CC=C1CCCC1)(C[Sn](C)(C)C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H16F3O3S2.3CH3.Sn/c1-17(2,8-7-9-5-3-4-6-9)16-18(14,15)10(11,12)13;;;;/h7H,1,3-6,8H2,2H3;3*1H3; |
| InChIKey | SAMRMTOOFPHOFO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.18 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|