C13H23F3O3S2 — CID 139683368
[[(2Z)-3,7-dimethylocta-2,6-dienyl]-dimethyl-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 139683368) has the molecular formula C13H23F3O3S2 and a molecular weight of 348.45 g/mol. Its IUPAC name is [[(2Z)-3,7-dimethylocta-2,6-dienyl]-dimethyl-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [[(2Z)-3,7-dimethylocta-2,6-dienyl]-dimethyl-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139683368 |
| Molecular Formula | C13H23F3O3S2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | [[(2Z)-3,7-dimethylocta-2,6-dienyl]-dimethyl-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CC(C)=CCC/C(C)=C\CS(C)(C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C13H23F3O3S2/c1-11(2)7-6-8-12(3)9-10-20(4,5)19-21(17,18)13(14,15)16/h7,9H,6,8,10H2,1-5H3/b12-9- |
| InChIKey | BTTVXBMGTAUYGL-XFXZXTDPSA-N |
| XLogP | 4.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|