C19H34N4O3 — CID 109147237
4-(4-acetylpiperazine-1-carbonyl)-N-[3-(dimethylamino)propyl]cyclohexane-1-carboxamide (PubChem CID 109147237) has the molecular formula C19H34N4O3 and a molecular weight of 366.51 g/mol. Its IUPAC name is 4-(4-acetylpiperazine-1-carbonyl)-N-[3-(dimethylamino)propyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(4-acetylpiperazine-1-carbonyl)-N-[3-(dimethylamino)propyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109147237 |
| Molecular Formula | C19H34N4O3 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | 4-(4-acetylpiperazine-1-carbonyl)-N-[3-(dimethylamino)propyl]cyclohexane-1-carboxamide |
| SMILES | CC(=O)N1CCN(C(=O)C2CCC(C(=O)NCCCN(C)C)CC2)CC1 |
| InChI | InChI=1S/C19H34N4O3/c1-15(24)22-11-13-23(14-12-22)19(26)17-7-5-16(6-8-17)18(25)20-9-4-10-21(2)3/h16-17H,4-14H2,1-3H3,(H,20,25) |
| InChIKey | PYMJJGDOHQCCMD-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|