C18H33N3O2 — CID 109147401
4-(4-methylpiperazine-1-carbonyl)-N-pentylcyclohexane-1-carboxamide (PubChem CID 109147401) has the molecular formula C18H33N3O2 and a molecular weight of 323.48 g/mol. Its IUPAC name is 4-(4-methylpiperazine-1-carbonyl)-N-pentylcyclohexane-1-carboxamide.
| Compound Name | 4-(4-methylpiperazine-1-carbonyl)-N-pentylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109147401 |
| Molecular Formula | C18H33N3O2 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.26 |
| IUPAC Name | 4-(4-methylpiperazine-1-carbonyl)-N-pentylcyclohexane-1-carboxamide |
| SMILES | CCCCCNC(=O)C1CCC(C(=O)N2CCN(C)CC2)CC1 |
| InChI | InChI=1S/C18H33N3O2/c1-3-4-5-10-19-17(22)15-6-8-16(9-7-15)18(23)21-13-11-20(2)12-14-21/h15-16H,3-14H2,1-2H3,(H,19,22) |
| InChIKey | LBXFVQACAKKXAP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|