C22H31N3O3 — CID 109147720
4-(4-acetylpiperazine-1-carbonyl)-N-(4-ethylphenyl)cyclohexane-1-carboxamide (PubChem CID 109147720) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 4-(4-acetylpiperazine-1-carbonyl)-N-(4-ethylphenyl)cyclohexane-1-carboxamide.
| Compound Name | 4-(4-acetylpiperazine-1-carbonyl)-N-(4-ethylphenyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 109147720 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 4-(4-acetylpiperazine-1-carbonyl)-N-(4-ethylphenyl)cyclohexane-1-carboxamide |
| SMILES | CCc1ccc(NC(=O)C2CCC(C(=O)N3CCN(C(C)=O)CC3)CC2)cc1 |
| InChI | InChI=1S/C22H31N3O3/c1-3-17-4-10-20(11-5-17)23-21(27)18-6-8-19(9-7-18)22(28)25-14-12-24(13-15-25)16(2)26/h4-5,10-11,18-19H,3,6-9,12-15H2,1-2H3,(H,23,27) |
| InChIKey | GWOKCKUOJXWMAL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |