C21H29N3O4 — CID 109147465
methyl 4-[[4-(4-methylpiperazine-1-carbonyl)cyclohexanecarbonyl]amino]benzoate (PubChem CID 109147465) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is methyl 4-[[4-(4-methylpiperazine-1-carbonyl)cyclohexanecarbonyl]amino]benzoate.
| Compound Name | methyl 4-[[4-(4-methylpiperazine-1-carbonyl)cyclohexanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109147465 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | methyl 4-[[4-(4-methylpiperazine-1-carbonyl)cyclohexanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CCC(C(=O)N3CCN(C)CC3)CC2)cc1 |
| InChI | InChI=1S/C21H29N3O4/c1-23-11-13-24(14-12-23)20(26)16-5-3-15(4-6-16)19(25)22-18-9-7-17(8-10-18)21(27)28-2/h7-10,15-16H,3-6,11-14H2,1-2H3,(H,22,25) |
| InChIKey | XGVUBSIMPLMYRZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |