C21H28N2O4 — CID 109146046
methyl 4-[[4-(piperidine-1-carbonyl)cyclohexanecarbonyl]amino]benzoate (PubChem CID 109146046) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is methyl 4-[[4-(piperidine-1-carbonyl)cyclohexanecarbonyl]amino]benzoate.
| Compound Name | methyl 4-[[4-(piperidine-1-carbonyl)cyclohexanecarbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109146046 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | methyl 4-[[4-(piperidine-1-carbonyl)cyclohexanecarbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)C2CCC(C(=O)N3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C21H28N2O4/c1-27-21(26)17-9-11-18(12-10-17)22-19(24)15-5-7-16(8-6-15)20(25)23-13-3-2-4-14-23/h9-12,15-16H,2-8,13-14H2,1H3,(H,22,24) |
| InChIKey | HQWLONZOJOKJAY-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |