About Methyl 4-{1-[6-(piperidin-1-YL)pyrimidin-4-YL]piperidine-4-amido}benzoate
Methyl 4-{1-[6-(piperidin-1-YL)pyrimidin-4-YL]piperidine-4-amido}benzoate (PubChem CID 53170457) has the molecular formula C23H29N5O3
and a molecular weight of 423.50 g/mol. Its IUPAC name is methyl 4-[[1-(6-piperidin-1-ylpyrimidin-4-yl)piperidine-4-carbonyl]amino]benzoate.
Molecular Properties
| Compound Name | Methyl 4-{1-[6-(piperidin-1-YL)pyrimidin-4-YL]piperidine-4-amido}benzoate |
| PubChem CID | 53170457 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | methyl 4-[[1-(6-piperidin-1-ylpyrimidin-4-yl)piperidine-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)C1=CC=C(C=C1)NC(=O)C2CCN(CC2)C3=NC=NC(=C3)N4CCCCC4 |
| InChI | InChI=1S/C23H29N5O3/c1-31-23(30)18-5-7-19(8-6-18)26-22(29)17-9-13-28(14-10-17)21-15-20(24-16-25-21)27-11-3-2-4-12-27/h5-8,15-17H,2-4,9-14H2,1H3,(H,26,29) |
| InChIKey | BSKAALAATPBXPS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | 596 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze Methyl 4-{1-[6-(piperidin-1-YL)pyrimidin-4-YL]piperidine-4-amido}benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Methyl 4-{1-[6-(piperidin-1-YL)pyrimidin-4-YL]piperidine-4-amido}benzoate?
The IUPAC name of Methyl 4-{1-[6-(piperidin-1-YL)pyrimidin-4-YL]piperidine-4-amido}benzoate (CID 53170457) is methyl 4-[[1-(6-piperidin-1-ylpyrimidin-4-yl)piperidine-4-carbonyl]amino]benzoate.
What is the SMILES notation for Methyl 4-{1-[6-(piperidin-1-YL)pyrimidin-4-YL]piperidine-4-amido}benzoate?
The canonical SMILES for Methyl 4-{1-[6-(piperidin-1-YL)pyrimidin-4-YL]piperidine-4-amido}benzoate is COC(=O)C1=CC=C(C=C1)NC(=O)C2CCN(CC2)C3=NC=NC(=C3)N4CCCCC4.
What is the InChIKey of Methyl 4-{1-[6-(piperidin-1-YL)pyrimidin-4-YL]piperidine-4-amido}benzoate?
The InChIKey is BSKAALAATPBXPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29N5O3/c1-31-23(30)18-5-7-19(8-6-18)26-22(29)17-9-13-28(14-10-17)21-15-20(24-16-25-21)27-11-3-2-4-12-27/h5-8,15-17H,2-4,9-14H2,1H3,(H,26,29).
What are the key properties of Methyl 4-{1-[6-(piperidin-1-YL)pyrimidin-4-YL]piperidine-4-amido}benzoate?
Methyl 4-{1-[6-(piperidin-1-YL)pyrimidin-4-YL]piperidine-4-amido}benzoate has a molecular weight of 423.50 g/mol, XLogP of 3.10, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Methyl 4-{1-[6-(piperidin-1-YL)pyrimidin-4-YL]piperidine-4-amido}benzoate is sourced from PubChem (CID 53170457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).