C26H28N4O4 — CID 90519480
ethyl 4-[[1-[6-(4-methoxyphenyl)pyrimidin-4-yl]piperidine-4-carbonyl]amino]benzoate (PubChem CID 90519480) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is ethyl 4-[[1-[6-(4-methoxyphenyl)pyrimidin-4-yl]piperidine-4-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[1-[6-(4-methoxyphenyl)pyrimidin-4-yl]piperidine-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 90519480 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | ethyl 4-[[1-[6-(4-methoxyphenyl)pyrimidin-4-yl]piperidine-4-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CCN(c3cc(-c4ccc(OC)cc4)ncn3)CC2)cc1 |
| InChI | InChI=1S/C26H28N4O4/c1-3-34-26(32)20-4-8-21(9-5-20)29-25(31)19-12-14-30(15-13-19)24-16-23(27-17-28-24)18-6-10-22(33-2)11-7-18/h4-11,16-17,19H,3,12-15H2,1-2H3,(H,29,31) |
| InChIKey | GTPAWLGZZXKLAP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |